C15H11N3O2 — CID 39471728
(E)-3-(1,3-benzoxazol-2-yl)-N-pyridin-4-ylprop-2-enamide (PubChem CID 39471728) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 39471728 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-pyridin-4-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)Nc1ccncc1 |
| InChI | InChI=1S/C15H11N3O2/c19-14(17-11-7-9-16-10-8-11)5-6-15-18-12-3-1-2-4-13(12)20-15/h1-10H,(H,16,17,19)/b6-5+ |
| InChIKey | NMCZVGYSPJCJBB-AATRIKPKSA-N |
| XLogP | 2.87 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|