C18H16N2O4 — CID 17413045
(E)-3-(1,3-benzoxazol-2-yl)-N-(2,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 17413045) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-(2,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-(2,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17413045 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-(2,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2nc3ccccc3o2)c(OC)c1 |
| InChI | InChI=1S/C18H16N2O4/c1-22-12-7-8-14(16(11-12)23-2)19-17(21)9-10-18-20-13-5-3-4-6-15(13)24-18/h3-11H,1-2H3,(H,19,21)/b10-9+ |
| InChIKey | XGFZUAHLDGQDFS-MDZDMXLPSA-N |
| XLogP | 3.50 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|