C20H17NO6 — CID 8696965
[2-(2,5-dimethoxyphenyl)-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate (PubChem CID 8696965) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is [2-(2,5-dimethoxyphenyl)-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate.
| Compound Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8696965 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [2-(2,5-dimethoxyphenyl)-2-oxoethyl] (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(C(=O)COC(=O)/C=C/c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C20H17NO6/c1-24-13-7-8-17(25-2)14(11-13)16(22)12-26-20(23)10-9-19-21-15-5-3-4-6-18(15)27-19/h3-11H,12H2,1-2H3/b10-9+ |
| InChIKey | MQPRFFSAMFAZHA-MDZDMXLPSA-N |
| XLogP | 3.28 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|