C22H22N2O4 — CID 33080925
(E)-3-(1,3-benzoxazol-2-yl)-N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 33080925) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 33080925 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(CN(C(=O)/C=C/c2nc3ccccc3o2)C2CC2)c1 |
| InChI | InChI=1S/C22H22N2O4/c1-26-17-9-10-19(27-2)15(13-17)14-24(16-7-8-16)22(25)12-11-21-23-18-5-3-4-6-20(18)28-21/h3-6,9-13,16H,7-8,14H2,1-2H3/b12-11+ |
| InChIKey | IOQRNGWSHDOOIQ-VAWYXSNFSA-N |
| XLogP | 4.05 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|