C21H22N2O5 — CID 33078421
(E)-N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 33078421) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (E)-N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 33078421 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (E)-N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(CN(C(=O)/C=C/c2ccccc2[N+](=O)[O-])C2CC2)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-27-18-10-11-20(28-2)16(13-18)14-22(17-8-9-17)21(24)12-7-15-5-3-4-6-19(15)23(25)26/h3-7,10-13,17H,8-9,14H2,1-2H3/b12-7+ |
| InChIKey | DKJZGWFXCHNSBM-KPKJPENVSA-N |
| XLogP | 3.82 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|