C19H20N2O5 — CID 33078016
N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]-4-nitrobenzamide (PubChem CID 33078016) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]-4-nitrobenzamide.
| Compound Name | N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 33078016 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-cyclopropyl-N-[(2,5-dimethoxyphenyl)methyl]-4-nitrobenzamide |
| SMILES | COc1ccc(OC)c(CN(C(=O)c2ccc([N+](=O)[O-])cc2)C2CC2)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-25-17-9-10-18(26-2)14(11-17)12-20(15-7-8-15)19(22)13-3-5-16(6-4-13)21(23)24/h3-6,9-11,15H,7-8,12H2,1-2H3 |
| InChIKey | OOVLIEALSUNVBS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|