C19H18N2O4 — CID 51189008
(E)-3-(1,3-benzoxazol-2-yl)-N-[(3,4-dimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 51189008) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[(3,4-dimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[(3,4-dimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 51189008 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[(3,4-dimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C=C/c2nc3ccccc3o2)cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-23-16-8-7-13(11-17(16)24-2)12-20-18(22)9-10-19-21-14-5-3-4-6-15(14)25-19/h3-11H,12H2,1-2H3,(H,20,22)/b10-9+ |
| InChIKey | NORJYBJZHRGJMQ-MDZDMXLPSA-N |
| XLogP | 3.17 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|