C20H15N3O3 — CID 97462691
(Z)-3-(1,3-benzoxazol-2-yl)-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]prop-2-enamide (PubChem CID 97462691) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is (Z)-3-(1,3-benzoxazol-2-yl)-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]prop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzoxazol-2-yl)-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 97462691 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (Z)-3-(1,3-benzoxazol-2-yl)-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C\c1nc2ccccc2o1)NCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H15N3O3/c24-19(10-11-20-22-16-8-4-5-9-17(16)25-20)21-13-15-12-18(26-23-15)14-6-2-1-3-7-14/h1-12H,13H2,(H,21,24)/b11-10- |
| InChIKey | LNUDNLFEMSNTCV-KHPPLWFESA-N |
| XLogP | 3.81 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|