C15H18N2O3 — CID 77056591
3-(1,3-benzoxazol-2-yl)-N-(2-hydroxy-2-methylbutyl)prop-2-enamide (PubChem CID 77056591) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N-(2-hydroxy-2-methylbutyl)prop-2-enamide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N-(2-hydroxy-2-methylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 77056591 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N-(2-hydroxy-2-methylbutyl)prop-2-enamide |
| SMILES | CCC(C)(O)CNC(=O)C=Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C15H18N2O3/c1-3-15(2,19)10-16-13(18)8-9-14-17-11-6-4-5-7-12(11)20-14/h4-9,19H,3,10H2,1-2H3,(H,16,18) |
| InChIKey | UPBJQDOJHZIYPC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|