C21H29N3O4 — CID 72690817
tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-ethylbutyl]carbamate (PubChem CID 72690817) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-ethylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-ethylbutyl]carbamate |
|---|---|
| PubChem CID | 72690817 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl N-[2-[3-(1,3-benzoxazol-2-yl)prop-2-enoylamino]-2-ethylbutyl]carbamate |
| SMILES | CCC(CC)(CNC(=O)OC(C)(C)C)NC(=O)C=Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C21H29N3O4/c1-6-21(7-2,14-22-19(26)28-20(3,4)5)24-17(25)12-13-18-23-15-10-8-9-11-16(15)27-18/h8-13H,6-7,14H2,1-5H3,(H,22,26)(H,24,25) |
| InChIKey | DCHHJSSCPWQLOP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|