C22H22N2O3 — CID 143003672
tert-butyl N-[4-[(1E,3E)-4-(1,3-benzoxazol-2-yl)buta-1,3-dienyl]phenyl]carbamate (PubChem CID 143003672) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is tert-butyl N-[4-[(1E,3E)-4-(1,3-benzoxazol-2-yl)buta-1,3-dienyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1E,3E)-4-(1,3-benzoxazol-2-yl)buta-1,3-dienyl]phenyl]carbamate |
|---|---|
| PubChem CID | 143003672 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | tert-butyl N-[4-[(1E,3E)-4-(1,3-benzoxazol-2-yl)buta-1,3-dienyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(/C=C/C=C/c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H22N2O3/c1-22(2,3)27-21(25)23-17-14-12-16(13-15-17)8-4-7-11-20-24-18-9-5-6-10-19(18)26-20/h4-15H,1-3H3,(H,23,25)/b8-4+,11-7+ |
| InChIKey | ITDZIYLPGUSBFN-RIALUSDFSA-N |
| XLogP | 5.90 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|