C13H16N2O3 — CID 65142575
tert-butyl N-(2-methyl-1,3-benzoxazol-5-yl)carbamate (PubChem CID 65142575) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-1,3-benzoxazol-5-yl)carbamate.
| Compound Name | tert-butyl N-(2-methyl-1,3-benzoxazol-5-yl)carbamate |
|---|---|
| PubChem CID | 65142575 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | tert-butyl N-(2-methyl-1,3-benzoxazol-5-yl)carbamate |
| SMILES | Cc1nc2cc(NC(=O)OC(C)(C)C)ccc2o1 |
| InChI | InChI=1S/C13H16N2O3/c1-8-14-10-7-9(5-6-11(10)17-8)15-12(16)18-13(2,3)4/h5-7H,1-4H3,(H,15,16) |
| InChIKey | NQVHTRKTHQEOGR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |