C19H20N2O3 — CID 166446222
tert-butyl N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamate (PubChem CID 166446222) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 166446222 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl N-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamate |
| SMILES | Cc1ccc2oc(-c3ccc(NC(=O)OC(C)(C)C)cc3)nc2c1 |
| InChI | InChI=1S/C19H20N2O3/c1-12-5-10-16-15(11-12)21-17(23-16)13-6-8-14(9-7-13)20-18(22)24-19(2,3)4/h5-11H,1-4H3,(H,20,22) |
| InChIKey | OAJNYYVXQOUTFO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |