C16H14N2O2 — CID 17100800
N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide (PubChem CID 17100800) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide.
| Compound Name | N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 17100800 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2nc3ccc(C)cc3o2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-10-3-8-14-15(9-10)20-16(18-14)12-4-6-13(7-5-12)17-11(2)19/h3-9H,1-2H3,(H,17,19) |
| InChIKey | MLXYLGMMBMZDBO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |