C32H24N4O4 — CID 101118961
(E)-N,N'-bis[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]but-2-enediamide (PubChem CID 101118961) has the molecular formula C32H24N4O4 and a molecular weight of 528.57 g/mol. Its IUPAC name is (E)-N,N'-bis[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]but-2-enediamide.
| Compound Name | (E)-N,N'-bis[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]but-2-enediamide |
|---|---|
| PubChem CID | 101118961 |
| Molecular Formula | C32H24N4O4 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (E)-N,N'-bis[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]but-2-enediamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)/C=C/C(=O)Nc4ccc(-c5nc6ccc(C)cc6o5)cc4)cc3)oc2c1 |
| InChI | InChI=1S/C32H24N4O4/c1-19-3-13-25-27(17-19)39-31(35-25)21-5-9-23(10-6-21)33-29(37)15-16-30(38)34-24-11-7-22(8-12-24)32-36-26-14-4-20(2)18-28(26)40-32/h3-18H,1-2H3,(H,33,37)(H,34,38)/b16-15+ |
| InChIKey | VWSDBJCKLWNLHX-FOCLMDBBSA-N |
| XLogP | 7.05 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|