C25H24N2O4 — CID 1363581
3,5-diethoxy-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 1363581) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3,5-diethoxy-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | 3,5-diethoxy-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 1363581 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3,5-diethoxy-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | CCOc1cc(OCC)cc(C(=O)Nc2ccc(-c3nc4ccc(C)cc4o3)cc2)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-4-29-20-13-18(14-21(15-20)30-5-2)24(28)26-19-9-7-17(8-10-19)25-27-22-11-6-16(3)12-23(22)31-25/h6-15H,4-5H2,1-3H3,(H,26,28) |
| InChIKey | WFQSPLAFTNVYLM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |