C21H11F5N2O2 — CID 3363557
2,3,4,5,6-pentafluoro-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 3363557) has the molecular formula C21H11F5N2O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 3363557 |
| Molecular Formula | C21H11F5N2O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)c4c(F)c(F)c(F)c(F)c4F)cc3)oc2c1 |
| InChI | InChI=1S/C21H11F5N2O2/c1-9-2-7-12-13(8-9)30-21(28-12)10-3-5-11(6-4-10)27-20(29)14-15(22)17(24)19(26)18(25)16(14)23/h2-8H,1H3,(H,27,29) |
| InChIKey | XUGFLMNYZPYLDK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|