C22H14F4N2O4 — CID 17110623
2,3,5,6-tetrafluoro-4-methoxy-N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 17110623) has the molecular formula C22H14F4N2O4 and a molecular weight of 446.36 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 17110623 |
| Molecular Formula | C22H14F4N2O4 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | COc1ccc2oc(-c3ccc(NC(=O)c4c(F)c(F)c(OC)c(F)c4F)cc3)nc2c1 |
| InChI | InChI=1S/C22H14F4N2O4/c1-30-12-7-8-14-13(9-12)28-22(32-14)10-3-5-11(6-4-10)27-21(29)15-16(23)18(25)20(31-2)19(26)17(15)24/h3-9H,1-2H3,(H,27,29) |
| InChIKey | SHVGXIHHKYKWKV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|