C21H15FN2O3 — CID 5234955
3-fluoro-N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]benzamide (PubChem CID 5234955) has the molecular formula C21H15FN2O3 and a molecular weight of 362.36 g/mol. Its IUPAC name is 3-fluoro-N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 5234955 |
| Molecular Formula | C21H15FN2O3 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-fluoro-N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]benzamide |
| SMILES | COc1ccc2oc(-c3ccc(NC(=O)c4cccc(F)c4)cc3)nc2c1 |
| InChI | InChI=1S/C21H15FN2O3/c1-26-17-9-10-19-18(12-17)24-21(27-19)13-5-7-16(8-6-13)23-20(25)14-3-2-4-15(22)11-14/h2-12H,1H3,(H,23,25) |
| InChIKey | OGPSAJNRZZAJQO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |