C19H12FN3O2 — CID 2996567
3-fluoro-N-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)benzamide (PubChem CID 2996567) has the molecular formula C19H12FN3O2 and a molecular weight of 333.32 g/mol. Its IUPAC name is 3-fluoro-N-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 3-fluoro-N-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 2996567 |
| Molecular Formula | C19H12FN3O2 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-fluoro-N-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2oc(-c3cccnc3)nc2c1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H12FN3O2/c20-14-5-1-3-12(9-14)18(24)22-15-6-7-17-16(10-15)23-19(25-17)13-4-2-8-21-11-13/h1-11H,(H,22,24) |
| InChIKey | WMVDTKXNNIALSO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |