C19H11ClN4O4 — CID 1363694
4-chloro-3-nitro-N-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)benzamide (PubChem CID 1363694) has the molecular formula C19H11ClN4O4 and a molecular weight of 394.77 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 4-chloro-3-nitro-N-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 1363694 |
| Molecular Formula | C19H11ClN4O4 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 4-chloro-3-nitro-N-(2-pyridin-3-yl-1,3-benzoxazol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2oc(-c3cccnc3)nc2c1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H11ClN4O4/c20-14-5-3-11(8-16(14)24(26)27)18(25)22-13-4-6-17-15(9-13)23-19(28-17)12-2-1-7-21-10-12/h1-10H,(H,22,25) |
| InChIKey | ZEAFBECCTFZQIK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|