C22H17FN2O2 — CID 1363898
N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-3-fluorobenzamide (PubChem CID 1363898) has the molecular formula C22H17FN2O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-3-fluorobenzamide.
| Compound Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 1363898 |
| Molecular Formula | C22H17FN2O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-3-fluorobenzamide |
| SMILES | CCc1ccc2oc(-c3cccc(NC(=O)c4cccc(F)c4)c3)nc2c1 |
| InChI | InChI=1S/C22H17FN2O2/c1-2-14-9-10-20-19(11-14)25-22(27-20)16-6-4-8-18(13-16)24-21(26)15-5-3-7-17(23)12-15/h3-13H,2H2,1H3,(H,24,26) |
| InChIKey | UVNQNSWGQUTXLT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |