C23H20N2O2 — CID 1365709
N-[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-3-methylbenzamide (PubChem CID 1365709) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-3-methylbenzamide.
| Compound Name | N-[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 1365709 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[4-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-3-methylbenzamide |
| SMILES | CCc1ccc2oc(-c3ccc(NC(=O)c4cccc(C)c4)cc3)nc2c1 |
| InChI | InChI=1S/C23H20N2O2/c1-3-16-7-12-21-20(14-16)25-23(27-21)17-8-10-19(11-9-17)24-22(26)18-6-4-5-15(2)13-18/h4-14H,3H2,1-2H3,(H,24,26) |
| InChIKey | FJELOAABZXNALE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |