C23H19FN2O3 — CID 2268437
N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]-3-propoxybenzamide (PubChem CID 2268437) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]-3-propoxybenzamide.
| Compound Name | N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]-3-propoxybenzamide |
|---|---|
| PubChem CID | 2268437 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)Nc2ccc3oc(-c4cccc(F)c4)nc3c2)c1 |
| InChI | InChI=1S/C23H19FN2O3/c1-2-11-28-19-8-4-5-15(13-19)22(27)25-18-9-10-21-20(14-18)26-23(29-21)16-6-3-7-17(24)12-16/h3-10,12-14H,2,11H2,1H3,(H,25,27) |
| InChIKey | KKFIWBLBDUDETR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |