C24H20Cl2N2O3 — CID 3117238
3-butoxy-N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 3117238) has the molecular formula C24H20Cl2N2O3 and a molecular weight of 455.34 g/mol. Its IUPAC name is 3-butoxy-N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 3-butoxy-N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 3117238 |
| Molecular Formula | C24H20Cl2N2O3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 3-butoxy-N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2ccc3oc(-c4cc(Cl)ccc4Cl)nc3c2)c1 |
| InChI | InChI=1S/C24H20Cl2N2O3/c1-2-3-11-30-18-6-4-5-15(12-18)23(29)27-17-8-10-22-21(14-17)28-24(31-22)19-13-16(25)7-9-20(19)26/h4-10,12-14H,2-3,11H2,1H3,(H,27,29) |
| InChIKey | KAVGKIYOCXNCEC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|