C22H16Cl2N2O2 — CID 3893327
N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]-4-ethylbenzamide (PubChem CID 3893327) has the molecular formula C22H16Cl2N2O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]-4-ethylbenzamide.
| Compound Name | N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 3893327 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N-[2-(2,5-dichlorophenyl)-1,3-benzoxazol-5-yl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc3oc(-c4cc(Cl)ccc4Cl)nc3c2)cc1 |
| InChI | InChI=1S/C22H16Cl2N2O2/c1-2-13-3-5-14(6-4-13)21(27)25-16-8-10-20-19(12-16)26-22(28-20)17-11-15(23)7-9-18(17)24/h3-12H,2H2,1H3,(H,25,27) |
| InChIKey | UVACDYSYVAHPSU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |