C24H21ClN2O3 — CID 2275762
N-[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-4-ethoxybenzamide (PubChem CID 2275762) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-4-ethoxybenzamide.
| Compound Name | N-[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 2275762 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(Cl)c(-c3nc4cc(CC)ccc4o3)c2)cc1 |
| InChI | InChI=1S/C24H21ClN2O3/c1-3-15-5-12-22-21(13-15)27-24(30-22)19-14-17(8-11-20(19)25)26-23(28)16-6-9-18(10-7-16)29-4-2/h5-14H,3-4H2,1-2H3,(H,26,28) |
| InChIKey | BZUZMLWAISQUIH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |