C24H21ClN2O2 — CID 17018338
N-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-ethylbenzamide (PubChem CID 17018338) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is N-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-ethylbenzamide.
| Compound Name | N-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 17018338 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[4-chloro-3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(Cl)c(-c3nc4cc(C)cc(C)c4o3)c2)cc1 |
| InChI | InChI=1S/C24H21ClN2O2/c1-4-16-5-7-17(8-6-16)23(28)26-18-9-10-20(25)19(13-18)24-27-21-12-14(2)11-15(3)22(21)29-24/h5-13H,4H2,1-3H3,(H,26,28) |
| InChIKey | NQXQQZMNMXWECY-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |