C30H24ClN3O3S — CID 17314516
N-[[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-phenylmethoxybenzamide (PubChem CID 17314516) has the molecular formula C30H24ClN3O3S and a molecular weight of 542.06 g/mol. Its IUPAC name is N-[[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17314516 |
| Molecular Formula | C30H24ClN3O3S |
| Molecular Weight | 542.06 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | N-[[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-phenylmethoxybenzamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=S)NC(=O)c4cccc(OCc5ccccc5)c4)ccc3Cl)nc2c1 |
| InChI | InChI=1S/C30H24ClN3O3S/c1-2-19-11-14-27-26(15-19)33-29(37-27)24-17-22(12-13-25(24)31)32-30(38)34-28(35)21-9-6-10-23(16-21)36-18-20-7-4-3-5-8-20/h3-17H,2,18H2,1H3,(H2,32,34,35,38) |
| InChIKey | FRTZXZDVAGVPKX-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.06 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|