C29H24N2O4 — CID 135625673
N-[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-3-phenylmethoxybenzamide (PubChem CID 135625673) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 135625673 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]-3-phenylmethoxybenzamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=O)c4cccc(OCc5ccccc5)c4)ccc3O)nc2c1 |
| InChI | InChI=1S/C29H24N2O4/c1-2-19-11-14-27-25(15-19)31-29(35-27)24-17-22(12-13-26(24)32)30-28(33)21-9-6-10-23(16-21)34-18-20-7-4-3-5-8-20/h3-17,32H,2,18H2,1H3,(H,30,33) |
| InChIKey | GIMDGBDYKQZEET-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|