C31H21ClN2O3 — CID 21213245
N-[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(phenoxymethyl)benzamide (PubChem CID 21213245) has the molecular formula C31H21ClN2O3 and a molecular weight of 504.97 g/mol. Its IUPAC name is N-[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(phenoxymethyl)benzamide.
| Compound Name | N-[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 21213245 |
| Molecular Formula | C31H21ClN2O3 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | N-[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(phenoxymethyl)benzamide |
| SMILES | O=C(Nc1ccc2oc(-c3cccc4c(Cl)cccc34)nc2c1)c1cccc(COc2ccccc2)c1 |
| InChI | InChI=1S/C31H21ClN2O3/c32-27-14-6-11-24-25(27)12-5-13-26(24)31-34-28-18-22(15-16-29(28)37-31)33-30(35)21-8-4-7-20(17-21)19-36-23-9-2-1-3-10-23/h1-18H,19H2,(H,33,35) |
| InChIKey | GRYCSHHLPAFREM-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |