C30H25N3O4S — CID 137118515
N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-phenylmethoxybenzamide (PubChem CID 137118515) has the molecular formula C30H25N3O4S and a molecular weight of 523.61 g/mol. Its IUPAC name is N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 137118515 |
| Molecular Formula | C30H25N3O4S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-phenylmethoxybenzamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=S)NC(=O)c4ccc(OCc5ccccc5)cc4)ccc3O)nc2c1 |
| InChI | InChI=1S/C30H25N3O4S/c1-2-19-8-15-27-25(16-19)32-29(37-27)24-17-22(11-14-26(24)34)31-30(38)33-28(35)21-9-12-23(13-10-21)36-18-20-6-4-3-5-7-20/h3-17,34H,2,18H2,1H3,(H2,31,33,35,38) |
| InChIKey | SFSWQQWGLALMTK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|