C25H21N3O3S — CID 135718113
(E)-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 135718113) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is (E)-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 135718113 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (E)-N-[[3-(5-ethyl-1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | CCc1ccc2oc(-c3cc(NC(=S)NC(=O)/C=C/c4ccccc4)ccc3O)nc2c1 |
| InChI | InChI=1S/C25H21N3O3S/c1-2-16-8-12-22-20(14-16)27-24(31-22)19-15-18(10-11-21(19)29)26-25(32)28-23(30)13-9-17-6-4-3-5-7-17/h3-15,29H,2H2,1H3,(H2,26,28,30,32)/b13-9+ |
| InChIKey | JSYROEXJIVBXRF-UKTHLTGXSA-N |
| XLogP | 5.29 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|