C32H30N4O3S — CID 21169614
N-[[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylmethoxybenzamide (PubChem CID 21169614) has the molecular formula C32H30N4O3S and a molecular weight of 550.68 g/mol. Its IUPAC name is N-[[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 21169614 |
| Molecular Formula | C32H30N4O3S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | N-[[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]carbamothioyl]-4-phenylmethoxybenzamide |
| SMILES | CCN(CC)c1ccc(-c2nc3cc(NC(=S)NC(=O)c4ccc(OCc5ccccc5)cc4)ccc3o2)cc1 |
| InChI | InChI=1S/C32H30N4O3S/c1-3-36(4-2)26-15-10-24(11-16-26)31-34-28-20-25(14-19-29(28)39-31)33-32(40)35-30(37)23-12-17-27(18-13-23)38-21-22-8-6-5-7-9-22/h5-20H,3-4,21H2,1-2H3,(H2,33,35,37,40) |
| InChIKey | AMHZSEAJTBWZLP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|