C29H23N3O3S — CID 17113508
N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-phenylmethoxybenzamide (PubChem CID 17113508) has the molecular formula C29H23N3O3S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17113508 |
| Molecular Formula | C29H23N3O3S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-4-phenylmethoxybenzamide |
| SMILES | Cc1ccc2oc(-c3cccc(NC(=S)NC(=O)c4ccc(OCc5ccccc5)cc4)c3)nc2c1 |
| InChI | InChI=1S/C29H23N3O3S/c1-19-10-15-26-25(16-19)31-28(35-26)22-8-5-9-23(17-22)30-29(36)32-27(33)21-11-13-24(14-12-21)34-18-20-6-3-2-4-7-20/h2-17H,18H2,1H3,(H2,30,32,33,36) |
| InChIKey | PRUMBGGHNTXMHZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|