C31H27N3O3S — CID 17314459
N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-4-phenylmethoxybenzamide (PubChem CID 17314459) has the molecular formula C31H27N3O3S and a molecular weight of 521.64 g/mol. Its IUPAC name is N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17314459 |
| Molecular Formula | C31H27N3O3S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-4-phenylmethoxybenzamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(C)c(NC(=S)NC(=O)c4ccc(OCc5ccccc5)cc4)c3)nc2c1 |
| InChI | InChI=1S/C31H27N3O3S/c1-19-15-21(3)28-27(16-19)32-30(37-28)24-10-9-20(2)26(17-24)33-31(38)34-29(35)23-11-13-25(14-12-23)36-18-22-7-5-4-6-8-22/h4-17H,18H2,1-3H3,(H2,33,34,35,38) |
| InChIKey | ZUGWCHYVCPBUKH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|