C29H24BrN3O3S — CID 17315384
4-bromo-N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 17315384) has the molecular formula C29H24BrN3O3S and a molecular weight of 574.50 g/mol. Its IUPAC name is 4-bromo-N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | 4-bromo-N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17315384 |
| Molecular Formula | C29H24BrN3O3S |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | 4-bromo-N-[[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2cc(-c3nc4cc(C)cc(C)c4o3)ccc2C)cc2ccccc2c1Br |
| InChI | InChI=1S/C29H24BrN3O3S/c1-15-11-17(3)25-23(12-15)31-28(36-25)19-10-9-16(2)22(14-19)32-29(37)33-27(34)21-13-18-7-5-6-8-20(18)24(30)26(21)35-4/h5-14H,1-4H3,(H2,32,33,34,37) |
| InChIKey | AVPGKUBMWDNIDS-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|