C26H17BrClN3O3S — CID 17315368
N-[[5-(1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-4-bromo-3-methoxynaphthalene-2-carboxamide (PubChem CID 17315368) has the molecular formula C26H17BrClN3O3S and a molecular weight of 566.86 g/mol. Its IUPAC name is N-[[5-(1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-4-bromo-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[5-(1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-4-bromo-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17315368 |
| Molecular Formula | C26H17BrClN3O3S |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 564.99 |
| IUPAC Name | N-[[5-(1,3-benzoxazol-2-yl)-2-chlorophenyl]carbamothioyl]-4-bromo-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2cc(-c3nc4ccccc4o3)ccc2Cl)cc2ccccc2c1Br |
| InChI | InChI=1S/C26H17BrClN3O3S/c1-33-23-17(12-14-6-2-3-7-16(14)22(23)27)24(32)31-26(35)30-20-13-15(10-11-18(20)28)25-29-19-8-4-5-9-21(19)34-25/h2-13H,1H3,(H2,30,31,32,35) |
| InChIKey | FFTNVQPFTXTICU-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|