C20H14BrClN2O4S — CID 17114232
4-[(4-bromo-3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-2-chlorobenzoic acid (PubChem CID 17114232) has the molecular formula C20H14BrClN2O4S and a molecular weight of 493.77 g/mol. Its IUPAC name is 4-[(4-bromo-3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-2-chlorobenzoic acid.
| Compound Name | 4-[(4-bromo-3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 17114232 |
| Molecular Formula | C20H14BrClN2O4S |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 491.95 |
| IUPAC Name | 4-[(4-bromo-3-methoxynaphthalene-2-carbonyl)carbamothioylamino]-2-chlorobenzoic acid |
| SMILES | COc1c(C(=O)NC(=S)Nc2ccc(C(=O)O)c(Cl)c2)cc2ccccc2c1Br |
| InChI | InChI=1S/C20H14BrClN2O4S/c1-28-17-14(8-10-4-2-3-5-12(10)16(17)21)18(25)24-20(29)23-11-6-7-13(19(26)27)15(22)9-11/h2-9H,1H3,(H,26,27)(H2,23,24,25,29) |
| InChIKey | SKQGONOCDHZORK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|