C19H13Br3N2O3S — CID 17316037
4-bromo-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 17316037) has the molecular formula C19H13Br3N2O3S and a molecular weight of 589.10 g/mol. Its IUPAC name is 4-bromo-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | 4-bromo-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17316037 |
| Molecular Formula | C19H13Br3N2O3S |
| Molecular Weight | 589.10 g/mol |
| Exact Mass | 585.82 |
| IUPAC Name | 4-bromo-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2cc(Br)c(O)c(Br)c2)cc2ccccc2c1Br |
| InChI | InChI=1S/C19H13Br3N2O3S/c1-27-17-12(6-9-4-2-3-5-11(9)15(17)22)18(26)24-19(28)23-10-7-13(20)16(25)14(21)8-10/h2-8,25H,1H3,(H2,23,24,26,28) |
| InChIKey | OVHHKHTUVMVLIV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.10 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|