C15H10Br2Cl2N2O3S — CID 5254358
3,5-dichloro-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-2-methoxybenzamide (PubChem CID 5254358) has the molecular formula C15H10Br2Cl2N2O3S and a molecular weight of 529.04 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 5254358 |
| Molecular Formula | C15H10Br2Cl2N2O3S |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 525.82 |
| IUPAC Name | 3,5-dichloro-N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)Nc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H10Br2Cl2N2O3S/c1-24-13-8(2-6(18)3-11(13)19)14(23)21-15(25)20-7-4-9(16)12(22)10(17)5-7/h2-5,22H,1H3,(H2,20,21,23,25) |
| InChIKey | KQGRFGDIOTVWDG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|