C16H10Cl2I2N2O4S — CID 3249221
2-[(3,5-dichloro-2-methoxybenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid (PubChem CID 3249221) has the molecular formula C16H10Cl2I2N2O4S and a molecular weight of 651.05 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-methoxybenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid.
| Compound Name | 2-[(3,5-dichloro-2-methoxybenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 3249221 |
| Molecular Formula | C16H10Cl2I2N2O4S |
| Molecular Weight | 651.05 g/mol |
| Exact Mass | 649.78 |
| IUPAC Name | 2-[(3,5-dichloro-2-methoxybenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)Nc1c(I)cc(I)cc1C(=O)O |
| InChI | InChI=1S/C16H10Cl2I2N2O4S/c1-26-13-9(2-6(17)3-10(13)18)14(23)22-16(27)21-12-8(15(24)25)4-7(19)5-11(12)20/h2-5H,1H3,(H,24,25)(H2,21,22,23,27) |
| InChIKey | RTPPMUKRBHUXFV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.05 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|