C15H8I4N2O3S — CID 3251562
2-[(2,5-diiodobenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid (PubChem CID 3251562) has the molecular formula C15H8I4N2O3S and a molecular weight of 803.92 g/mol. Its IUPAC name is 2-[(2,5-diiodobenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid.
| Compound Name | 2-[(2,5-diiodobenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 3251562 |
| Molecular Formula | C15H8I4N2O3S |
| Molecular Weight | 803.92 g/mol |
| Exact Mass | 803.64 |
| IUPAC Name | 2-[(2,5-diiodobenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid |
| SMILES | O=C(NC(=S)Nc1c(I)cc(I)cc1C(=O)O)c1cc(I)ccc1I |
| InChI | InChI=1S/C15H8I4N2O3S/c16-6-1-2-10(18)8(3-6)13(22)21-15(25)20-12-9(14(23)24)4-7(17)5-11(12)19/h1-5H,(H,23,24)(H2,20,21,22,25) |
| InChIKey | HCALBJSGBOEISE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.92 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|