C21H22I2N2O4S — CID 3251566
2-[(4-hexoxybenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid (PubChem CID 3251566) has the molecular formula C21H22I2N2O4S and a molecular weight of 652.29 g/mol. Its IUPAC name is 2-[(4-hexoxybenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid.
| Compound Name | 2-[(4-hexoxybenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 3251566 |
| Molecular Formula | C21H22I2N2O4S |
| Molecular Weight | 652.29 g/mol |
| Exact Mass | 651.94 |
| IUPAC Name | 2-[(4-hexoxybenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2c(I)cc(I)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H22I2N2O4S/c1-2-3-4-5-10-29-15-8-6-13(7-9-15)19(26)25-21(30)24-18-16(20(27)28)11-14(22)12-17(18)23/h6-9,11-12H,2-5,10H2,1H3,(H,27,28)(H2,24,25,26,30) |
| InChIKey | DAYIUYVQTQNHFS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.29 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|