C17H14I2N2O3S — CID 5195945
2-[(3,4-dimethylbenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid (PubChem CID 5195945) has the molecular formula C17H14I2N2O3S and a molecular weight of 580.19 g/mol. Its IUPAC name is 2-[(3,4-dimethylbenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid.
| Compound Name | 2-[(3,4-dimethylbenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 5195945 |
| Molecular Formula | C17H14I2N2O3S |
| Molecular Weight | 580.19 g/mol |
| Exact Mass | 579.88 |
| IUPAC Name | 2-[(3,4-dimethylbenzoyl)carbamothioylamino]-3,5-diiodobenzoic acid |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2c(I)cc(I)cc2C(=O)O)cc1C |
| InChI | InChI=1S/C17H14I2N2O3S/c1-8-3-4-10(5-9(8)2)15(22)21-17(25)20-14-12(16(23)24)6-11(18)7-13(14)19/h3-7H,1-2H3,(H,23,24)(H2,20,21,22,25) |
| InChIKey | HCMFZOKYZDNESD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|