C15H9I3N2O3S — CID 3249226
3,5-diiodo-2-[(2-iodobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 3249226) has the molecular formula C15H9I3N2O3S and a molecular weight of 678.03 g/mol. Its IUPAC name is 3,5-diiodo-2-[(2-iodobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 3,5-diiodo-2-[(2-iodobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3249226 |
| Molecular Formula | C15H9I3N2O3S |
| Molecular Weight | 678.03 g/mol |
| Exact Mass | 677.75 |
| IUPAC Name | 3,5-diiodo-2-[(2-iodobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(NC(=S)Nc1c(I)cc(I)cc1C(=O)O)c1ccccc1I |
| InChI | InChI=1S/C15H9I3N2O3S/c16-7-5-9(14(22)23)12(11(18)6-7)19-15(24)20-13(21)8-3-1-2-4-10(8)17/h1-6H,(H,22,23)(H2,19,20,21,24) |
| InChIKey | WVUXKKDAAMXKNL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.03 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|