C12H11ClI2N2O3S — CID 5193315
2-(4-chlorobutanoylcarbamothioylamino)-3,5-diiodobenzoic acid (PubChem CID 5193315) has the molecular formula C12H11ClI2N2O3S and a molecular weight of 552.56 g/mol. Its IUPAC name is 2-(4-chlorobutanoylcarbamothioylamino)-3,5-diiodobenzoic acid.
| Compound Name | 2-(4-chlorobutanoylcarbamothioylamino)-3,5-diiodobenzoic acid |
|---|---|
| PubChem CID | 5193315 |
| Molecular Formula | C12H11ClI2N2O3S |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 551.83 |
| IUPAC Name | 2-(4-chlorobutanoylcarbamothioylamino)-3,5-diiodobenzoic acid |
| SMILES | O=C(CCCCl)NC(=S)Nc1c(I)cc(I)cc1C(=O)O |
| InChI | InChI=1S/C12H11ClI2N2O3S/c13-3-1-2-9(18)16-12(21)17-10-7(11(19)20)4-6(14)5-8(10)15/h4-5H,1-3H2,(H,19,20)(H2,16,17,18,21) |
| InChIKey | JGMSKFXEWSGQSV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|