C12H13ClN2O3S — CID 4505326
4-(4-chlorobutanoylcarbamothioylamino)benzoic acid (PubChem CID 4505326) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is 4-(4-chlorobutanoylcarbamothioylamino)benzoic acid.
| Compound Name | 4-(4-chlorobutanoylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 4505326 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-(4-chlorobutanoylcarbamothioylamino)benzoic acid |
| SMILES | O=C(CCCCl)NC(=S)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H13ClN2O3S/c13-7-1-2-10(16)15-12(19)14-9-5-3-8(4-6-9)11(17)18/h3-6H,1-2,7H2,(H,17,18)(H2,14,15,16,19) |
| InChIKey | HDOLOOFYNGUQJF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|