C14H17ClN4O2S2 — CID 4659446
N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-4-chlorobutanamide (PubChem CID 4659446) has the molecular formula C14H17ClN4O2S2 and a molecular weight of 372.90 g/mol. Its IUPAC name is N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-4-chlorobutanamide.
| Compound Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-4-chlorobutanamide |
|---|---|
| PubChem CID | 4659446 |
| Molecular Formula | C14H17ClN4O2S2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-[[4-(acetylcarbamothioylamino)phenyl]carbamothioyl]-4-chlorobutanamide |
| SMILES | CC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)CCCCl)cc1 |
| InChI | InChI=1S/C14H17ClN4O2S2/c1-9(20)16-13(22)17-10-4-6-11(7-5-10)18-14(23)19-12(21)3-2-8-15/h4-7H,2-3,8H2,1H3,(H2,16,17,20,22)(H2,18,19,21,23) |
| InChIKey | IPEGOHZOHZTTIR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|