C20H20ClN3O2S — CID 7325850
4-chloro-N-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]butanamide (PubChem CID 7325850) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 4-chloro-N-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]butanamide.
| Compound Name | 4-chloro-N-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 7325850 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 4-chloro-N-[[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]butanamide |
| SMILES | Cc1cc2nc(-c3ccc(NC(=S)NC(=O)CCCCl)cc3)oc2cc1C |
| InChI | InChI=1S/C20H20ClN3O2S/c1-12-10-16-17(11-13(12)2)26-19(23-16)14-5-7-15(8-6-14)22-20(27)24-18(25)4-3-9-21/h5-8,10-11H,3-4,9H2,1-2H3,(H2,22,24,25,27) |
| InChIKey | PBTRECRBBPAGOU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|